C22H27O4P — CID 146245379
(4-ethylphenyl)-[4-(5-prop-2-enoyloxypentoxy)phenyl]phosphinous acid (PubChem CID 146245379) has the molecular formula C22H27O4P and a molecular weight of 386.43 g/mol. Its IUPAC name is (4-ethylphenyl)-[4-(5-prop-2-enoyloxypentoxy)phenyl]phosphinous acid.
| Compound Name | (4-ethylphenyl)-[4-(5-prop-2-enoyloxypentoxy)phenyl]phosphinous acid |
|---|---|
| PubChem CID | 146245379 |
| Molecular Formula | C22H27O4P |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (4-ethylphenyl)-[4-(5-prop-2-enoyloxypentoxy)phenyl]phosphinous acid |
| SMILES | C=CC(=O)OCCCCCOc1ccc(P(O)c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C22H27O4P/c1-3-18-8-12-20(13-9-18)27(24)21-14-10-19(11-15-21)25-16-6-5-7-17-26-22(23)4-2/h4,8-15,24H,2-3,5-7,16-17H2,1H3 |
| InChIKey | AJNGFTBCZYNHLD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|