C24H29FN4O5 — CID 146251953
tert-butyl 4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 146251953) has the molecular formula C24H29FN4O5 and a molecular weight of 472.52 g/mol. Its IUPAC name is tert-butyl 4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146251953 |
| Molecular Formula | C24H29FN4O5 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | tert-butyl 4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/c1cn(-c2ccc(F)cc2)c(=O)c(N2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C24H29FN4O5/c1-5-33-20(30)11-8-18-16-29(19-9-6-17(25)7-10-19)22(31)21(26-18)27-12-14-28(15-13-27)23(32)34-24(2,3)4/h6-11,16H,5,12-15H2,1-4H3/b11-8+ |
| InChIKey | YQKFOLCNJCYFPW-DHZHZOJOSA-N |
| XLogP | 3.01 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|