C12H9F9N6S — CID 146258771
4-N-(2,2,2-trifluoroethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 146258771) has the molecular formula C12H9F9N6S and a molecular weight of 440.30 g/mol. Its IUPAC name is 4-N-(2,2,2-trifluoroethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(2,2,2-trifluoroethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 146258771 |
| Molecular Formula | C12H9F9N6S |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 4-N-(2,2,2-trifluoroethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Nc1nc(NCC(F)(F)F)nc(-c2csc(C(F)(F)F)n2)n1)C(F)(F)F |
| InChI | InChI=1S/C12H9F9N6S/c1-4(11(16,17)18)23-9-26-6(5-2-28-7(24-5)12(19,20)21)25-8(27-9)22-3-10(13,14)15/h2,4H,3H2,1H3,(H2,22,23,25,26,27) |
| InChIKey | JEEVRAWCGIASRA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |