C16H20O — CID 146274063
3-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-2H-chromene (PubChem CID 146274063) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-2H-chromene.
| Compound Name | 3-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 146274063 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-2H-chromene |
| SMILES | C/C=C\C=C(/C)CC1COc2ccccc2C1 |
| InChI | InChI=1S/C16H20O/c1-3-4-7-13(2)10-14-11-15-8-5-6-9-16(15)17-12-14/h3-9,14H,10-12H2,1-2H3/b4-3-,13-7+ |
| InChIKey | UGYPQGYDICEWMZ-XYJZBGMCSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|