C10H11ClN4O3S — CID 146275527
2-chloro-9-(1,1-dioxothian-4-yl)-7H-purin-8-one (PubChem CID 146275527) has the molecular formula C10H11ClN4O3S and a molecular weight of 302.74 g/mol. Its IUPAC name is 2-chloro-9-(1,1-dioxothian-4-yl)-7H-purin-8-one.
| Compound Name | 2-chloro-9-(1,1-dioxothian-4-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 146275527 |
| Molecular Formula | C10H11ClN4O3S |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-chloro-9-(1,1-dioxothian-4-yl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(Cl)nc2n1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H11ClN4O3S/c11-9-12-5-7-8(14-9)15(10(16)13-7)6-1-3-19(17,18)4-2-6/h5-6H,1-4H2,(H,13,16) |
| InChIKey | IAOPWIZDFBZIPM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |