C10H12N4O3S — CID 141313283
9-(1,1-dioxothiolan-3-yl)-7-methylpurin-8-one (PubChem CID 141313283) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 9-(1,1-dioxothiolan-3-yl)-7-methylpurin-8-one.
| Compound Name | 9-(1,1-dioxothiolan-3-yl)-7-methylpurin-8-one |
|---|---|
| PubChem CID | 141313283 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 9-(1,1-dioxothiolan-3-yl)-7-methylpurin-8-one |
| SMILES | Cn1c(=O)n(C2CCS(=O)(=O)C2)c2ncncc21 |
| InChI | InChI=1S/C10H12N4O3S/c1-13-8-4-11-6-12-9(8)14(10(13)15)7-2-3-18(16,17)5-7/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | BDLXNAIWJRRNCI-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |