About 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine
4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine (PubChem CID 146278352) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine.
Analyze 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine?
The IUPAC name of 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine (CID 146278352) is 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine.
What is the SMILES notation for 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine?
The canonical SMILES for 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine is CC1CCNC2=COCC=C21.
What is the InChIKey of 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine?
The InChIKey is MWILAWYGEOUNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-2-4-10-9-6-11-5-3-8(7)9/h3,6-7,10H,2,4-5H2,1H3.
What are the key properties of 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine?
4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine has a molecular weight of 151.21 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3,4,6-tetrahydro-1H-pyrano[3,4-b]pyridine is sourced from PubChem (CID 146278352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).