C15H26N2O — CID 143694645
(3E)-N-methyl-5-piperidin-4-yl-3-propan-2-yloxyhexa-1,3,5-trien-2-amine (PubChem CID 143694645) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (3E)-N-methyl-5-piperidin-4-yl-3-propan-2-yloxyhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-N-methyl-5-piperidin-4-yl-3-propan-2-yloxyhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143694645 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (3E)-N-methyl-5-piperidin-4-yl-3-propan-2-yloxyhexa-1,3,5-trien-2-amine |
| SMILES | C=C(NC)/C(=C\C(=C)C1CCNCC1)OC(C)C |
| InChI | InChI=1S/C15H26N2O/c1-11(2)18-15(13(4)16-5)10-12(3)14-6-8-17-9-7-14/h10-11,14,16-17H,3-4,6-9H2,1-2,5H3/b15-10+ |
| InChIKey | NKNKMHKJWVWALN-XNTDXEJSSA-N |
| XLogP | 2.58 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|