C12H11N5O2S — CID 146279763
[3-[(2S)-2-azido-2-(1,3-thiazol-2-yl)ethyl]phenyl]carbamic acid (PubChem CID 146279763) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is [3-[(2S)-2-azido-2-(1,3-thiazol-2-yl)ethyl]phenyl]carbamic acid.
| Compound Name | [3-[(2S)-2-azido-2-(1,3-thiazol-2-yl)ethyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 146279763 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | [3-[(2S)-2-azido-2-(1,3-thiazol-2-yl)ethyl]phenyl]carbamic acid |
| SMILES | [N-]=[N+]=N[C@@H](Cc1cccc(NC(=O)O)c1)c1nccs1 |
| InChI | InChI=1S/C12H11N5O2S/c13-17-16-10(11-14-4-5-20-11)7-8-2-1-3-9(6-8)15-12(18)19/h1-6,10,15H,7H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | GMYMXAYQJDPYIA-JTQLQIEISA-N |
| XLogP | 3.83 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|