C9H23O4P3 — CID 146281386
2-phosphanylbutan-2-yl 3-phosphanylpentan-3-yl hydrogen phosphate (PubChem CID 146281386) has the molecular formula C9H23O4P3 and a molecular weight of 288.20 g/mol. Its IUPAC name is 2-phosphanylbutan-2-yl 3-phosphanylpentan-3-yl hydrogen phosphate.
| Compound Name | 2-phosphanylbutan-2-yl 3-phosphanylpentan-3-yl hydrogen phosphate |
|---|---|
| PubChem CID | 146281386 |
| Molecular Formula | C9H23O4P3 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-phosphanylbutan-2-yl 3-phosphanylpentan-3-yl hydrogen phosphate |
| SMILES | CCC(C)(P)OP(=O)(O)OC(P)(CC)CC |
| InChI | InChI=1S/C9H23O4P3/c1-5-8(4,14)12-16(10,11)13-9(15,6-2)7-3/h5-7,14-15H2,1-4H3,(H,10,11) |
| InChIKey | QCPMWTHBFSQDFD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|