C22H36N6O6 — CID 146291073
(2S)-2-[[(1S)-1-azido-2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]amino]-N-[4-(hydroxymethyl)phenyl]propanamide (PubChem CID 146291073) has the molecular formula C22H36N6O6 and a molecular weight of 480.57 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-azido-2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]amino]-N-[4-(hydroxymethyl)phenyl]propanamide.
| Compound Name | (2S)-2-[[(1S)-1-azido-2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]amino]-N-[4-(hydroxymethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 146291073 |
| Molecular Formula | C22H36N6O6 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (2S)-2-[[(1S)-1-azido-2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]amino]-N-[4-(hydroxymethyl)phenyl]propanamide |
| SMILES | CC(C)NC(=O)CCOCCOCCOC[C@H](N=[N+]=[N-])N[C@@H](C)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C22H36N6O6/c1-16(2)24-21(30)8-9-32-10-11-33-12-13-34-15-20(27-28-23)25-17(3)22(31)26-19-6-4-18(14-29)5-7-19/h4-7,16-17,20,25,29H,8-15H2,1-3H3,(H,24,30)(H,26,31)/t17-,20-/m0/s1 |
| InChIKey | NAXNJHMRUUFECB-PXNSSMCTSA-N |
| XLogP | 1.70 |
| TPSA | 166.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|