C24H39N6O10P — CID 167283534
[4-[[(2S)-2-[[(2S)-2-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl dihydrogen phosphate (PubChem CID 167283534) has the molecular formula C24H39N6O10P and a molecular weight of 602.58 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-2-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl dihydrogen phosphate.
| Compound Name | [4-[[(2S)-2-[[(2S)-2-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 167283534 |
| Molecular Formula | C24H39N6O10P |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-2-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl dihydrogen phosphate |
| SMILES | CC(C)[C@H](NC(=O)CCOCCOCCOCCN=[N+]=[N-])C(=O)N[C@@H](C)C(=O)Nc1ccc(COP(=O)(O)O)cc1 |
| InChI | InChI=1S/C24H39N6O10P/c1-17(2)22(29-21(31)8-10-37-12-14-39-15-13-38-11-9-26-30-25)24(33)27-18(3)23(32)28-20-6-4-19(5-7-20)16-40-41(34,35)36/h4-7,17-18,22H,8-16H2,1-3H3,(H,27,33)(H,28,32)(H,29,31)(H2,34,35,36)/t18-,22-/m0/s1 |
| InChIKey | ILGOMPZRIBBNEC-AVRDEDQJSA-N |
| XLogP | 1.63 |
| TPSA | 230.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|