C26H41N7O7 — CID 157398042
[4-[[(2S)-2-[[(2S)-6-[2-(2-azidoethoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate (PubChem CID 157398042) has the molecular formula C26H41N7O7 and a molecular weight of 563.66 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-6-[2-(2-azidoethoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate.
| Compound Name | [4-[[(2S)-2-[[(2S)-6-[2-(2-azidoethoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 157398042 |
| Molecular Formula | C26H41N7O7 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-6-[2-(2-azidoethoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate |
| SMILES | CC(C)C(CC(=O)CCOCCOCCN=[N+]=[N-])C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)NCCN)cc1 |
| InChI | InChI=1S/C26H41N7O7/c1-18(2)23(16-22(34)8-12-38-14-15-39-13-11-30-33-28)25(36)31-19(3)24(35)32-21-6-4-20(5-7-21)17-40-26(37)29-10-9-27/h4-7,18-19,23H,8-17,27H2,1-3H3,(H,29,37)(H,31,36)(H,32,35)/t19-,23?/m0/s1 |
| InChIKey | BMURQVCOKLZVMU-HSTJUUNISA-N |
| XLogP | 2.28 |
| TPSA | 206.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|