C29H45IN4O8 — CID 147942510
[4-[[(2S)-2-[[(2S)-6-[2-(5-iodo-4-oxopentoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate (PubChem CID 147942510) has the molecular formula C29H45IN4O8 and a molecular weight of 704.60 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-6-[2-(5-iodo-4-oxopentoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate.
| Compound Name | [4-[[(2S)-2-[[(2S)-6-[2-(5-iodo-4-oxopentoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 147942510 |
| Molecular Formula | C29H45IN4O8 |
| Molecular Weight | 704.60 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-6-[2-(5-iodo-4-oxopentoxy)ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl N-(2-aminoethyl)carbamate |
| SMILES | CC(C)C(CC(=O)CCOCCOCCCC(=O)CI)C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)NCCN)cc1 |
| InChI | InChI=1S/C29H45IN4O8/c1-20(2)26(17-24(35)10-14-41-16-15-40-13-4-5-25(36)18-30)28(38)33-21(3)27(37)34-23-8-6-22(7-9-23)19-42-29(39)32-12-11-31/h6-9,20-21,26H,4-5,10-19,31H2,1-3H3,(H,32,39)(H,33,38)(H,34,37)/t21-,26?/m0/s1 |
| InChIKey | IMAKVEXOYVQMMJ-GVNKFJBHSA-N |
| XLogP | 2.75 |
| TPSA | 175.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|