C30H45N3O11S — CID 160734911
(8R)-9-[[(2S)-1-[4-[[4-(2,2-dimethylpropoxy)-4-oxobutyl]carbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-8-methyl-2,6,9-trioxononane-3-sulfonic acid (PubChem CID 160734911) has the molecular formula C30H45N3O11S and a molecular weight of 655.77 g/mol. Its IUPAC name is (8R)-9-[[(2S)-1-[4-[[4-(2,2-dimethylpropoxy)-4-oxobutyl]carbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-8-methyl-2,6,9-trioxononane-3-sulfonic acid.
| Compound Name | (8R)-9-[[(2S)-1-[4-[[4-(2,2-dimethylpropoxy)-4-oxobutyl]carbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-8-methyl-2,6,9-trioxononane-3-sulfonic acid |
|---|---|
| PubChem CID | 160734911 |
| Molecular Formula | C30H45N3O11S |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.28 |
| IUPAC Name | (8R)-9-[[(2S)-1-[4-[[4-(2,2-dimethylpropoxy)-4-oxobutyl]carbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-8-methyl-2,6,9-trioxononane-3-sulfonic acid |
| SMILES | CC(=O)C(CCC(=O)C[C@@H](C)C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)NCCCC(=O)OCC(C)(C)C)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C30H45N3O11S/c1-19(16-24(35)13-14-25(21(3)34)45(40,41)42)27(37)32-20(2)28(38)33-23-11-9-22(10-12-23)17-43-29(39)31-15-7-8-26(36)44-18-30(4,5)6/h9-12,19-20,25H,7-8,13-18H2,1-6H3,(H,31,39)(H,32,37)(H,33,38)(H,40,41,42)/t19-,20+,25?/m1/s1 |
| InChIKey | RUUZNTVGECVYOF-DRNDDYJUSA-N |
| XLogP | 2.95 |
| TPSA | 211.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|