C29H43IN2O6 — CID 160917326
[4-[[(2S)-2-[[(2S)-9-iodo-4,8-dioxo-2-propan-2-ylnonanoyl]amino]propanoyl]amino]phenyl]methyl 4,4-dimethylpentanoate (PubChem CID 160917326) has the molecular formula C29H43IN2O6 and a molecular weight of 642.58 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-9-iodo-4,8-dioxo-2-propan-2-ylnonanoyl]amino]propanoyl]amino]phenyl]methyl 4,4-dimethylpentanoate.
| Compound Name | [4-[[(2S)-2-[[(2S)-9-iodo-4,8-dioxo-2-propan-2-ylnonanoyl]amino]propanoyl]amino]phenyl]methyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 160917326 |
| Molecular Formula | C29H43IN2O6 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-9-iodo-4,8-dioxo-2-propan-2-ylnonanoyl]amino]propanoyl]amino]phenyl]methyl 4,4-dimethylpentanoate |
| SMILES | CC(C)C(CC(=O)CCCC(=O)CI)C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)CCC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H43IN2O6/c1-19(2)25(16-23(33)8-7-9-24(34)17-30)28(37)31-20(3)27(36)32-22-12-10-21(11-13-22)18-38-26(35)14-15-29(4,5)6/h10-13,19-20,25H,7-9,14-18H2,1-6H3,(H,31,37)(H,32,36)/t20-,25?/m0/s1 |
| InChIKey | SRONZTINJQUJQM-JINQPTGOSA-N |
| XLogP | 5.41 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|