C27H27N5O3 — CID 146296121
8-[(4-methoxyphenyl)methyl]-11-morpholin-4-yl-5-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one (PubChem CID 146296121) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 8-[(4-methoxyphenyl)methyl]-11-morpholin-4-yl-5-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one.
| Compound Name | 8-[(4-methoxyphenyl)methyl]-11-morpholin-4-yl-5-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one |
|---|---|
| PubChem CID | 146296121 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 8-[(4-methoxyphenyl)methyl]-11-morpholin-4-yl-5-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one |
| SMILES | COc1ccc(CN2C(=O)N3C(=NCC3c3ccccc3)c3ncc(N4CCOCC4)cc32)cc1 |
| InChI | InChI=1S/C27H27N5O3/c1-34-22-9-7-19(8-10-22)18-31-23-15-21(30-11-13-35-14-12-30)16-28-25(23)26-29-17-24(32(26)27(31)33)20-5-3-2-4-6-20/h2-10,15-16,24H,11-14,17-18H2,1H3 |
| InChIKey | QFRMMYFEDHZYNZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |