C28H29N5O4 — CID 146295991
8-[(3,5-dimethoxyphenyl)methyl]-11-morpholin-4-yl-4-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one (PubChem CID 146295991) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is 8-[(3,5-dimethoxyphenyl)methyl]-11-morpholin-4-yl-4-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one.
| Compound Name | 8-[(3,5-dimethoxyphenyl)methyl]-11-morpholin-4-yl-4-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one |
|---|---|
| PubChem CID | 146295991 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 8-[(3,5-dimethoxyphenyl)methyl]-11-morpholin-4-yl-4-phenyl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one |
| SMILES | COc1cc(CN2C(=O)N3CC(c4ccccc4)N=C3c3ncc(N4CCOCC4)cc32)cc(OC)c1 |
| InChI | InChI=1S/C28H29N5O4/c1-35-22-12-19(13-23(15-22)36-2)17-32-25-14-21(31-8-10-37-11-9-31)16-29-26(25)27-30-24(18-33(27)28(32)34)20-6-4-3-5-7-20/h3-7,12-16,24H,8-11,17-18H2,1-2H3 |
| InChIKey | AZLQMQAUURBATP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |