C19H25N5O3 — CID 167187020
5-tert-butyl-8-ethyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione (PubChem CID 167187020) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-tert-butyl-8-ethyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione.
| Compound Name | 5-tert-butyl-8-ethyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione |
|---|---|
| PubChem CID | 167187020 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 5-tert-butyl-8-ethyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione |
| SMILES | CCN1C(=O)N2C(=NC(=O)C2C(C)(C)C)c2ncc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C19H25N5O3/c1-5-23-13-10-12(22-6-8-27-9-7-22)11-20-14(13)16-21-17(25)15(19(2,3)4)24(16)18(23)26/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | WBASUDCAZTZHND-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |