C26H33N5O4 — CID 146296122
8-[(3,5-dimethoxyphenyl)methyl]-5-(2-methylpropyl)-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one (PubChem CID 146296122) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 8-[(3,5-dimethoxyphenyl)methyl]-5-(2-methylpropyl)-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one.
| Compound Name | 8-[(3,5-dimethoxyphenyl)methyl]-5-(2-methylpropyl)-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one |
|---|---|
| PubChem CID | 146296122 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 8-[(3,5-dimethoxyphenyl)methyl]-5-(2-methylpropyl)-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-one |
| SMILES | COc1cc(CN2C(=O)N3C(=NCC3CC(C)C)c3ncc(N4CCOCC4)cc32)cc(OC)c1 |
| InChI | InChI=1S/C26H33N5O4/c1-17(2)9-20-15-28-25-24-23(12-19(14-27-24)29-5-7-35-8-6-29)30(26(32)31(20)25)16-18-10-21(33-3)13-22(11-18)34-4/h10-14,17,20H,5-9,15-16H2,1-4H3 |
| InChIKey | CRPCOHCDYQTAHJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |