C22H23N5O4 — CID 166705508
8-[(4-methoxyphenyl)methyl]-5-methyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione (PubChem CID 166705508) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 8-[(4-methoxyphenyl)methyl]-5-methyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione.
| Compound Name | 8-[(4-methoxyphenyl)methyl]-5-methyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione |
|---|---|
| PubChem CID | 166705508 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 8-[(4-methoxyphenyl)methyl]-5-methyl-11-morpholin-4-yl-3,6,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4,7-dione |
| SMILES | COc1ccc(CN2C(=O)N3C(=NC(=O)C3C)c3ncc(N4CCOCC4)cc32)cc1 |
| InChI | InChI=1S/C22H23N5O4/c1-14-21(28)24-20-19-18(11-16(12-23-19)25-7-9-31-10-8-25)26(22(29)27(14)20)13-15-3-5-17(30-2)6-4-15/h3-6,11-12,14H,7-10,13H2,1-2H3 |
| InChIKey | FTBFZYVARJDGNN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |