C13H21N3O2 — CID 146318106
[6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea (PubChem CID 146318106) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea.
| Compound Name | [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 146318106 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea |
| SMILES | COc1cc(C(C)C)c(NC(N)=O)c(C(C)C)n1 |
| InChI | InChI=1S/C13H21N3O2/c1-7(2)9-6-10(18-5)15-11(8(3)4)12(9)16-13(14)17/h6-8H,1-5H3,(H3,14,16,17) |
| InChIKey | BHYHDQQUMDFVMA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |