About [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea
[6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea (PubChem CID 146318106) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea.
Molecular Properties
| Compound Name | [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea |
| PubChem CID | 146318106 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea |
| SMILES | COc1cc(C(C)C)c(NC(N)=O)c(C(C)C)n1 |
| InChI | InChI=1S/C13H21N3O2/c1-7(2)9-6-10(18-5)15-11(8(3)4)12(9)16-13(14)17/h6-8H,1-5H3,(H3,14,16,17) |
| InChIKey | BHYHDQQUMDFVMA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea?
The IUPAC name of [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea (CID 146318106) is [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea.
What is the SMILES notation for [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea?
The canonical SMILES for [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea is COc1cc(C(C)C)c(NC(N)=O)c(C(C)C)n1.
What is the InChIKey of [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea?
The InChIKey is BHYHDQQUMDFVMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-7(2)9-6-10(18-5)15-11(8(3)4)12(9)16-13(14)17/h6-8H,1-5H3,(H3,14,16,17).
What are the key properties of [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea?
[6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea has a molecular weight of 251.33 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methoxy-2,4-di(propan-2-yl)-3-pyridinyl]urea is sourced from PubChem (CID 146318106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).