C14H23N3O — CID 153395922
N-[6-(methylamino)-2,4-di(propan-2-yl)-3-pyridinyl]acetamide (PubChem CID 153395922) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[6-(methylamino)-2,4-di(propan-2-yl)-3-pyridinyl]acetamide.
| Compound Name | N-[6-(methylamino)-2,4-di(propan-2-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 153395922 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-[6-(methylamino)-2,4-di(propan-2-yl)-3-pyridinyl]acetamide |
| SMILES | CNc1cc(C(C)C)c(NC(C)=O)c(C(C)C)n1 |
| InChI | InChI=1S/C14H23N3O/c1-8(2)11-7-12(15-6)17-13(9(3)4)14(11)16-10(5)18/h7-9H,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | YWZWYFQVJBSBNY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |