C29H29NO3 — CID 146318582
2-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-3-phenylmethoxychromen-4-one (PubChem CID 146318582) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-3-phenylmethoxychromen-4-one.
| Compound Name | 2-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-3-phenylmethoxychromen-4-one |
|---|---|
| PubChem CID | 146318582 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-3-phenylmethoxychromen-4-one |
| SMILES | CC1(C)CCN(c2ccc(-c3oc4ccccc4c(=O)c3OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H29NO3/c1-29(2)16-18-30(19-17-29)23-14-12-22(13-15-23)27-28(32-20-21-8-4-3-5-9-21)26(31)24-10-6-7-11-25(24)33-27/h3-15H,16-20H2,1-2H3 |
| InChIKey | LYBQPLSJMFEEJN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |