About (6R)-6-propylthian-2-one
(6R)-6-propylthian-2-one (PubChem CID 146319411) has the molecular formula C8H14OS
and a molecular weight of 158.27 g/mol. Its IUPAC name is (6R)-6-propylthian-2-one.
Molecular Properties
| Compound Name | (6R)-6-propylthian-2-one |
| PubChem CID | 146319411 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | (6R)-6-propylthian-2-one |
| SMILES | CCC[C@@H]1CCCC(=O)S1 |
| InChI | InChI=1S/C8H14OS/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | PRSGGNQGDWGRPA-SSDOTTSWSA-N |
| XLogP | 2.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-propylthian-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-propylthian-2-one?
The IUPAC name of (6R)-6-propylthian-2-one (CID 146319411) is (6R)-6-propylthian-2-one.
What is the SMILES notation for (6R)-6-propylthian-2-one?
The canonical SMILES for (6R)-6-propylthian-2-one is CCC[C@@H]1CCCC(=O)S1.
What is the InChIKey of (6R)-6-propylthian-2-one?
The InChIKey is PRSGGNQGDWGRPA-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14OS/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3/t7-/m1/s1.
What are the key properties of (6R)-6-propylthian-2-one?
(6R)-6-propylthian-2-one has a molecular weight of 158.27 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-propylthian-2-one is sourced from PubChem (CID 146319411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).