C10H16O2S — CID 131863198
(6Z)-2-(hydroxymethyl)-2,3,4,5,8,9-hexahydrothiecin-10-one (PubChem CID 131863198) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is (6Z)-2-(hydroxymethyl)-2,3,4,5,8,9-hexahydrothiecin-10-one.
| Compound Name | (6Z)-2-(hydroxymethyl)-2,3,4,5,8,9-hexahydrothiecin-10-one |
|---|---|
| PubChem CID | 131863198 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (6Z)-2-(hydroxymethyl)-2,3,4,5,8,9-hexahydrothiecin-10-one |
| SMILES | O=C1CC/C=C\CCCC(CO)S1 |
| InChI | InChI=1S/C10H16O2S/c11-8-9-6-4-2-1-3-5-7-10(12)13-9/h1,3,9,11H,2,4-8H2/b3-1- |
| InChIKey | ZYBGRIRKOTYGFF-IWQZZHSRSA-N |
| XLogP | 2.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|