C14H14Cl2N2O2S — CID 146323576
4,5-dichloro-N-(1,2-diethyl-6-oxo-3-pyridinyl)thiophene-2-carboxamide (PubChem CID 146323576) has the molecular formula C14H14Cl2N2O2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 4,5-dichloro-N-(1,2-diethyl-6-oxo-3-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(1,2-diethyl-6-oxo-3-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 146323576 |
| Molecular Formula | C14H14Cl2N2O2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 4,5-dichloro-N-(1,2-diethyl-6-oxo-3-pyridinyl)thiophene-2-carboxamide |
| SMILES | CCc1c(NC(=O)c2cc(Cl)c(Cl)s2)ccc(=O)n1CC |
| InChI | InChI=1S/C14H14Cl2N2O2S/c1-3-10-9(5-6-12(19)18(10)4-2)17-14(20)11-7-8(15)13(16)21-11/h5-7H,3-4H2,1-2H3,(H,17,20) |
| InChIKey | GVFHPKFMJUVTGW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |