C16H24N2O3 — CID 146324613
4,9-ditert-butyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8-trione (PubChem CID 146324613) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4,9-ditert-butyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8-trione.
| Compound Name | 4,9-ditert-butyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8-trione |
|---|---|
| PubChem CID | 146324613 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4,9-ditert-butyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8-trione |
| SMILES | CC(C)(C)N1CC2C(C1=O)C1C(=O)N(C(C)(C)C)C(=O)C21 |
| InChI | InChI=1S/C16H24N2O3/c1-15(2,3)17-7-8-9(12(17)19)11-10(8)13(20)18(14(11)21)16(4,5)6/h8-11H,7H2,1-6H3 |
| InChIKey | AHUYPNDNJPEFSV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|