C20H37NO2 — CID 158665325
methane;2,4,6-tritert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 158665325) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is methane;2,4,6-tritert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | methane;2,4,6-tritert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 158665325 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | methane;2,4,6-tritert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | C.CC(C)(C)C1CC(C(C)(C)C)C2C(=O)N(C(C)(C)C)C(=O)C21 |
| InChI | InChI=1S/C19H33NO2.CH4/c1-17(2,3)11-10-12(18(4,5)6)14-13(11)15(21)20(16(14)22)19(7,8)9;/h11-14H,10H2,1-9H3;1H4 |
| InChIKey | IDGVCNHXXOXLJU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|