C18H36N2O3 — CID 146328207
[1-butoxy-3-(2-methylaziridin-1-yl)propan-2-yl] N-heptylcarbamate (PubChem CID 146328207) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is [1-butoxy-3-(2-methylaziridin-1-yl)propan-2-yl] N-heptylcarbamate.
| Compound Name | [1-butoxy-3-(2-methylaziridin-1-yl)propan-2-yl] N-heptylcarbamate |
|---|---|
| PubChem CID | 146328207 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | [1-butoxy-3-(2-methylaziridin-1-yl)propan-2-yl] N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)OC(COCCCC)CN1CC1C |
| InChI | InChI=1S/C18H36N2O3/c1-4-6-8-9-10-11-19-18(21)23-17(14-20-13-16(20)3)15-22-12-7-5-2/h16-17H,4-15H2,1-3H3,(H,19,21) |
| InChIKey | IDKUKSIMBXTITL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|