C26H22N4 — CID 146329919
1-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-N-methylethanamine (PubChem CID 146329919) has the molecular formula C26H22N4 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-N-methylethanamine.
| Compound Name | 1-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 146329919 |
| Molecular Formula | C26H22N4 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-N-methylethanamine |
| SMILES | CNC(C)c1nc(-c2ccc3ccccc3c2)nc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C26H22N4/c1-17(27-2)24-28-25(22-13-11-18-7-3-5-9-20(18)15-22)30-26(29-24)23-14-12-19-8-4-6-10-21(19)16-23/h3-17,27H,1-2H3 |
| InChIKey | FAIPJJSNZNXPSY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |