C23H28N4O3 — CID 146347139
(2R,3S,4R,5R)-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-[(1S)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]oxolane-3,4-diol (PubChem CID 146347139) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-[(1S)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-[(1S)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 146347139 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (2R,3S,4R,5R)-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-[(1S)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H]([C@@H](C)c2cccc3c2CNCC3)[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C23H28N4O3/c1-13(16-6-4-5-15-7-9-24-11-18(15)16)20-23(3,29)19(28)22(30-20)27-10-8-17-14(2)25-12-26-21(17)27/h4-6,8,10,12-13,19-20,22,24,28-29H,7,9,11H2,1-3H3/t13-,19-,20+,22+,23-/m0/s1 |
| InChIKey | AGWRBBHAWLWZOE-IDUJSCLWSA-N |
| XLogP | 2.20 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |