C13H17FN2O3 — CID 146349385
N-[2-(2,2-dimethylpropyl)-4-fluoro-6-nitrophenyl]acetamide (PubChem CID 146349385) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpropyl)-4-fluoro-6-nitrophenyl]acetamide.
| Compound Name | N-[2-(2,2-dimethylpropyl)-4-fluoro-6-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 146349385 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[2-(2,2-dimethylpropyl)-4-fluoro-6-nitrophenyl]acetamide |
| SMILES | CC(=O)Nc1c(CC(C)(C)C)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17FN2O3/c1-8(17)15-12-9(7-13(2,3)4)5-10(14)6-11(12)16(18)19/h5-6H,7H2,1-4H3,(H,15,17) |
| InChIKey | CKKOLSMEDRPSEQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|