C8H17O7P — CID 146355896
(2-methoxy-3,3-dimethyl-1-methylperoxy-1-oxobutan-2-yl)phosphonic acid (PubChem CID 146355896) has the molecular formula C8H17O7P and a molecular weight of 256.19 g/mol. Its IUPAC name is (2-methoxy-3,3-dimethyl-1-methylperoxy-1-oxobutan-2-yl)phosphonic acid.
| Compound Name | (2-methoxy-3,3-dimethyl-1-methylperoxy-1-oxobutan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 146355896 |
| Molecular Formula | C8H17O7P |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (2-methoxy-3,3-dimethyl-1-methylperoxy-1-oxobutan-2-yl)phosphonic acid |
| SMILES | COOC(=O)C(OC)(C(C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C8H17O7P/c1-7(2,3)8(13-4,16(10,11)12)6(9)15-14-5/h1-5H3,(H2,10,11,12) |
| InChIKey | FHGRAGVWGOMZAD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|