C28H32N2O6 — CID 146364898
benzyl (2S)-3-prop-2-enoxy-2-[[(2S)-1-(2-prop-2-enoxybenzoyl)pyrrolidine-2-carbonyl]amino]propanoate (PubChem CID 146364898) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is benzyl (2S)-3-prop-2-enoxy-2-[[(2S)-1-(2-prop-2-enoxybenzoyl)pyrrolidine-2-carbonyl]amino]propanoate.
| Compound Name | benzyl (2S)-3-prop-2-enoxy-2-[[(2S)-1-(2-prop-2-enoxybenzoyl)pyrrolidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 146364898 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | benzyl (2S)-3-prop-2-enoxy-2-[[(2S)-1-(2-prop-2-enoxybenzoyl)pyrrolidine-2-carbonyl]amino]propanoate |
| SMILES | C=CCOC[C@H](NC(=O)[C@@H]1CCCN1C(=O)c1ccccc1OCC=C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H32N2O6/c1-3-17-34-20-23(28(33)36-19-21-11-6-5-7-12-21)29-26(31)24-14-10-16-30(24)27(32)22-13-8-9-15-25(22)35-18-4-2/h3-9,11-13,15,23-24H,1-2,10,14,16-20H2,(H,29,31)/t23-,24-/m0/s1 |
| InChIKey | UHKKTCHQPALBLP-ZEQRLZLVSA-N |
| XLogP | 3.29 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|