C21H25F3N2O6 — CID 101053186
benzyl (2S)-2-[[(2R,3R,4R)-4-hydroxy-3-methyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]amino]-3-prop-2-enoxypropanoate (PubChem CID 101053186) has the molecular formula C21H25F3N2O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2R,3R,4R)-4-hydroxy-3-methyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]amino]-3-prop-2-enoxypropanoate.
| Compound Name | benzyl (2S)-2-[[(2R,3R,4R)-4-hydroxy-3-methyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]amino]-3-prop-2-enoxypropanoate |
|---|---|
| PubChem CID | 101053186 |
| Molecular Formula | C21H25F3N2O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | benzyl (2S)-2-[[(2R,3R,4R)-4-hydroxy-3-methyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]amino]-3-prop-2-enoxypropanoate |
| SMILES | C=CCOC[C@H](NC(=O)[C@H]1[C@@H](C)[C@@H](O)CN1C(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25F3N2O6/c1-3-9-31-12-15(19(29)32-11-14-7-5-4-6-8-14)25-18(28)17-13(2)16(27)10-26(17)20(30)21(22,23)24/h3-8,13,15-17,27H,1,9-12H2,2H3,(H,25,28)/t13-,15-,16-,17+/m0/s1 |
| InChIKey | AVVYCQUBXICWQH-QSPRXWTASA-N |
| XLogP | 1.19 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|