C40H45N3O8 — CID 67061790
dibenzyl (2R)-2-[[(2S)-1-[2-[phenylmethoxycarbonyl(prop-2-enyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-prop-2-enylpentanedioate (PubChem CID 67061790) has the molecular formula C40H45N3O8 and a molecular weight of 695.81 g/mol. Its IUPAC name is dibenzyl (2R)-2-[[(2S)-1-[2-[phenylmethoxycarbonyl(prop-2-enyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-prop-2-enylpentanedioate.
| Compound Name | dibenzyl (2R)-2-[[(2S)-1-[2-[phenylmethoxycarbonyl(prop-2-enyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-prop-2-enylpentanedioate |
|---|---|
| PubChem CID | 67061790 |
| Molecular Formula | C40H45N3O8 |
| Molecular Weight | 695.81 g/mol |
| Exact Mass | 695.32 |
| IUPAC Name | dibenzyl (2R)-2-[[(2S)-1-[2-[phenylmethoxycarbonyl(prop-2-enyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-prop-2-enylpentanedioate |
| SMILES | C=CCC(C[C@@H](NC(=O)[C@@H]1CCCN1C(=O)CN(CC=C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H45N3O8/c1-3-15-33(38(46)49-27-30-16-8-5-9-17-30)25-34(39(47)50-28-31-18-10-6-11-19-31)41-37(45)35-22-14-24-43(35)36(44)26-42(23-4-2)40(48)51-29-32-20-12-7-13-21-32/h3-13,16-21,33-35H,1-2,14-15,22-29H2,(H,41,45)/t33?,34-,35+/m1/s1 |
| InChIKey | FKNHOMZOZSESRS-NZFROYLUSA-N |
| XLogP | 5.36 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|