C8H3F4IN2 — CID 146365047
4,5,6,7-tetrafluoro-3-iodo-2-methylindazole (PubChem CID 146365047) has the molecular formula C8H3F4IN2 and a molecular weight of 330.02 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-3-iodo-2-methylindazole.
| Compound Name | 4,5,6,7-tetrafluoro-3-iodo-2-methylindazole |
|---|---|
| PubChem CID | 146365047 |
| Molecular Formula | C8H3F4IN2 |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 4,5,6,7-tetrafluoro-3-iodo-2-methylindazole |
| SMILES | Cn1nc2c(F)c(F)c(F)c(F)c2c1I |
| InChI | InChI=1S/C8H3F4IN2/c1-15-8(13)2-3(9)4(10)5(11)6(12)7(2)14-15/h1H3 |
| InChIKey | USKGFJLJJRTLDV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|