C37H51NO6 — CID 146370469
2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-22-(4-ethoxycarbonyl-3-hydroxyphenyl)docosa-4,7,10,13,16,19-hexaenoyl]amino]-4-methylpentanoic acid (PubChem CID 146370469) has the molecular formula C37H51NO6 and a molecular weight of 605.82 g/mol. Its IUPAC name is 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-22-(4-ethoxycarbonyl-3-hydroxyphenyl)docosa-4,7,10,13,16,19-hexaenoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-22-(4-ethoxycarbonyl-3-hydroxyphenyl)docosa-4,7,10,13,16,19-hexaenoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 146370469 |
| Molecular Formula | C37H51NO6 |
| Molecular Weight | 605.82 g/mol |
| Exact Mass | 605.37 |
| IUPAC Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-22-(4-ethoxycarbonyl-3-hydroxyphenyl)docosa-4,7,10,13,16,19-hexaenoyl]amino]-4-methylpentanoic acid |
| SMILES | CCOC(=O)c1ccc(CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NC(CC(C)C)C(=O)O)cc1O |
| InChI | InChI=1S/C37H51NO6/c1-4-44-37(43)32-27-26-31(29-34(32)39)24-22-20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-23-25-35(40)38-33(36(41)42)28-30(2)3/h6-9,12-15,18-21,26-27,29-30,33,39H,4-5,10-11,16-17,22-25,28H2,1-3H3,(H,38,40)(H,41,42)/b8-6-,9-7-,14-12-,15-13-,20-18-,21-19- |
| InChIKey | KFKKHCPPXWLDQG-DOPDDKBTSA-N |
| XLogP | 8.18 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.82 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|