C21H23F — CID 146386330
5-fluoro-1,3-dimethyl-2-[(3E)-3-[(2-methylphenyl)methylidene]pent-1-en-2-yl]benzene (PubChem CID 146386330) has the molecular formula C21H23F and a molecular weight of 294.41 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-2-[(3E)-3-[(2-methylphenyl)methylidene]pent-1-en-2-yl]benzene.
| Compound Name | 5-fluoro-1,3-dimethyl-2-[(3E)-3-[(2-methylphenyl)methylidene]pent-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 146386330 |
| Molecular Formula | C21H23F |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-2-[(3E)-3-[(2-methylphenyl)methylidene]pent-1-en-2-yl]benzene |
| SMILES | C=C(/C(=C/c1ccccc1C)CC)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C21H23F/c1-6-18(13-19-10-8-7-9-14(19)2)17(5)21-15(3)11-20(22)12-16(21)4/h7-13H,5-6H2,1-4H3/b18-13+ |
| InChIKey | FZXXOHCRDMETBN-QGOAFFKASA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|