C37H30N2 — CID 146386348
N-(benzhydrylideneamino)-N-phenyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline (PubChem CID 146386348) has the molecular formula C37H30N2 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-(benzhydrylideneamino)-N-phenyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline.
| Compound Name | N-(benzhydrylideneamino)-N-phenyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 146386348 |
| Molecular Formula | C37H30N2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | N-(benzhydrylideneamino)-N-phenyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline |
| SMILES | C(=C/C=C/c1ccc(N(N=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1)\C=C\c1ccccc1 |
| InChI | InChI=1S/C37H30N2/c1(7-17-31-18-9-3-10-19-31)2-8-20-32-27-29-36(30-28-32)39(35-25-15-6-16-26-35)38-37(33-21-11-4-12-22-33)34-23-13-5-14-24-34/h1-30H/b2-1+,17-7+,20-8+ |
| InChIKey | CHWNFSGNDDVUSA-CNSLDWNGSA-N |
| XLogP | 9.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|