C10H20N2 — CID 146392524
(1Z,3Z)-1-N,3,5-trimethylhepta-1,3-diene-1,4-diamine (PubChem CID 146392524) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (1Z,3Z)-1-N,3,5-trimethylhepta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-N,3,5-trimethylhepta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 146392524 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (1Z,3Z)-1-N,3,5-trimethylhepta-1,3-diene-1,4-diamine |
| SMILES | CCC(C)/C(N)=C(C)/C=C\NC |
| InChI | InChI=1S/C10H20N2/c1-5-8(2)10(11)9(3)6-7-12-4/h6-8,12H,5,11H2,1-4H3/b7-6-,10-9- |
| InChIKey | JTKKBFUINKDFLZ-HZJYTTRNSA-N |
| XLogP | 2.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|