C14H21NO6 — CID 146394972
2-[[[(2R)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]methyl]oxolane-2,3,4-triol (PubChem CID 146394972) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-[[[(2R)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]methyl]oxolane-2,3,4-triol.
| Compound Name | 2-[[[(2R)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]methyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 146394972 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-[[[(2R)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]methyl]oxolane-2,3,4-triol |
| SMILES | OC1COC(O)(CN[C@H](Cc2ccccc2)C(O)O)C1O |
| InChI | InChI=1S/C14H21NO6/c16-11-7-21-14(20,12(11)17)8-15-10(13(18)19)6-9-4-2-1-3-5-9/h1-5,10-13,15-20H,6-8H2/t10-,11?,12?,14?/m1/s1 |
| InChIKey | XNWNQZRYDHRLRG-YAJDGLSUSA-N |
| XLogP | -2.06 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|