C17H14F3NOS2 — CID 146396077
2-butylsulfanyl-4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)benzonitrile (PubChem CID 146396077) has the molecular formula C17H14F3NOS2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-butylsulfanyl-4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)benzonitrile.
| Compound Name | 2-butylsulfanyl-4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)benzonitrile |
|---|---|
| PubChem CID | 146396077 |
| Molecular Formula | C17H14F3NOS2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-butylsulfanyl-4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)benzonitrile |
| SMILES | CCCCSc1cc(-c2cccs2)c(C(=O)C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C17H14F3NOS2/c1-2-3-6-24-15-9-12(14-5-4-7-23-14)13(8-11(15)10-21)16(22)17(18,19)20/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | JBLYDAZFBQBCSC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|