C23H23FN4 — CID 146410732
(Z)-1-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-(6-pyridin-2-yl-1,4-dihydropyridin-2-yl)prop-2-en-1-imine (PubChem CID 146410732) has the molecular formula C23H23FN4 and a molecular weight of 374.46 g/mol. Its IUPAC name is (Z)-1-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-(6-pyridin-2-yl-1,4-dihydropyridin-2-yl)prop-2-en-1-imine.
| Compound Name | (Z)-1-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-(6-pyridin-2-yl-1,4-dihydropyridin-2-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 146410732 |
| Molecular Formula | C23H23FN4 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (Z)-1-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-(6-pyridin-2-yl-1,4-dihydropyridin-2-yl)prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C\C1=CCC=C(c2ccccn2)N1)N1CCC[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C23H23FN4/c24-18-7-3-6-17(16-18)22-11-5-15-28(22)23(25)13-12-19-8-4-10-21(27-19)20-9-1-2-14-26-20/h1-3,6-10,12-14,16,22,25,27H,4-5,11,15H2/b13-12-,25-23-/t22-/m1/s1 |
| InChIKey | WVNNEQVJLZUPCQ-HLWJZIHWSA-N |
| XLogP | 4.81 |
| TPSA | 52.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|