C21H31NO4 — CID 146422395
methyl (3S)-3-[4-(2,6-dimethylhept-2-en-4-yl)-3-nitrophenyl]pentanoate (PubChem CID 146422395) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is methyl (3S)-3-[4-(2,6-dimethylhept-2-en-4-yl)-3-nitrophenyl]pentanoate.
| Compound Name | methyl (3S)-3-[4-(2,6-dimethylhept-2-en-4-yl)-3-nitrophenyl]pentanoate |
|---|---|
| PubChem CID | 146422395 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | methyl (3S)-3-[4-(2,6-dimethylhept-2-en-4-yl)-3-nitrophenyl]pentanoate |
| SMILES | CC[C@@H](CC(=O)OC)c1ccc(C(C=C(C)C)CC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H31NO4/c1-7-16(13-21(23)26-6)17-8-9-19(20(12-17)22(24)25)18(10-14(2)3)11-15(4)5/h8-10,12,15-16,18H,7,11,13H2,1-6H3/t16-,18?/m0/s1 |
| InChIKey | RPDZSWYOIUACTA-ATNAJCNCSA-N |
| XLogP | 5.75 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|