C18H16Cl3NO3 — CID 146425630
methyl 2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(4-chlorophenyl)acetate (PubChem CID 146425630) has the molecular formula C18H16Cl3NO3 and a molecular weight of 400.69 g/mol. Its IUPAC name is methyl 2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(4-chlorophenyl)acetate.
| Compound Name | methyl 2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 146425630 |
| Molecular Formula | C18H16Cl3NO3 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | methyl 2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(4-chlorophenyl)acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)N(Cc1ccc(Cl)cc1)C(=O)CCl |
| InChI | InChI=1S/C18H16Cl3NO3/c1-25-18(24)17(13-4-8-15(21)9-5-13)22(16(23)10-19)11-12-2-6-14(20)7-3-12/h2-9,17H,10-11H2,1H3 |
| InChIKey | ZSKYUSWYDFLQRV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|