C42H41N5 — CID 146428676
10-[3-(6-cyclohexa-1,3-dien-1-yl-3-methyl-4-phenyl-2,6-dihydro-1H-1,3,5-triazin-2-yl)-5-phenyl-2,3-dihydropyridin-2-yl]-9,9-dimethylacridine (PubChem CID 146428676) has the molecular formula C42H41N5 and a molecular weight of 615.83 g/mol. Its IUPAC name is 10-[3-(6-cyclohexa-1,3-dien-1-yl-3-methyl-4-phenyl-2,6-dihydro-1H-1,3,5-triazin-2-yl)-5-phenyl-2,3-dihydropyridin-2-yl]-9,9-dimethylacridine.
| Compound Name | 10-[3-(6-cyclohexa-1,3-dien-1-yl-3-methyl-4-phenyl-2,6-dihydro-1H-1,3,5-triazin-2-yl)-5-phenyl-2,3-dihydropyridin-2-yl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 146428676 |
| Molecular Formula | C42H41N5 |
| Molecular Weight | 615.83 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | 10-[3-(6-cyclohexa-1,3-dien-1-yl-3-methyl-4-phenyl-2,6-dihydro-1H-1,3,5-triazin-2-yl)-5-phenyl-2,3-dihydropyridin-2-yl]-9,9-dimethylacridine |
| SMILES | CN1C(c2ccccc2)=NC(C2=CC=CCC2)NC1C1C=C(c2ccccc2)C=NC1N1c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C42H41N5/c1-42(2)34-23-13-15-25-36(34)47(37-26-16-14-24-35(37)42)40-33(27-32(28-43-40)29-17-7-4-8-18-29)41-45-38(30-19-9-5-10-20-30)44-39(46(41)3)31-21-11-6-12-22-31/h4-9,11-19,21-28,33,38,40-41,45H,10,20H2,1-3H3 |
| InChIKey | KSGFMOKPENGHMR-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.83 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |