C40H40N4 — CID 146428839
9-[2-(4-cyclohexa-1,3-dien-1-yl-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-3-methyl-4-phenylcyclohexa-1,5-dien-1-yl]-3,4,4b,8a-tetrahydrocarbazole (PubChem CID 146428839) has the molecular formula C40H40N4 and a molecular weight of 576.79 g/mol. Its IUPAC name is 9-[2-(4-cyclohexa-1,3-dien-1-yl-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-3-methyl-4-phenylcyclohexa-1,5-dien-1-yl]-3,4,4b,8a-tetrahydrocarbazole.
| Compound Name | 9-[2-(4-cyclohexa-1,3-dien-1-yl-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-3-methyl-4-phenylcyclohexa-1,5-dien-1-yl]-3,4,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 146428839 |
| Molecular Formula | C40H40N4 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | 9-[2-(4-cyclohexa-1,3-dien-1-yl-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-3-methyl-4-phenylcyclohexa-1,5-dien-1-yl]-3,4,4b,8a-tetrahydrocarbazole |
| SMILES | CC1C(C2=NC(C3=CC=CCC3)NC(c3ccccc3)N2)=C(N2C3=C(CCC=C3)C3C=CC=CC32)C=CC1c1ccccc1 |
| InChI | InChI=1S/C40H40N4/c1-27-31(28-15-5-2-6-16-28)25-26-36(44-34-23-13-11-21-32(34)33-22-12-14-24-35(33)44)37(27)40-42-38(29-17-7-3-8-18-29)41-39(43-40)30-19-9-4-10-20-30/h2-9,11,13-19,21,23-27,31-32,34,38-39,41H,10,12,20,22H2,1H3,(H,42,43) |
| InChIKey | KXQPIIGUBQYOGG-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |