C8H25N7 — CID 146430861
1-[2-(dimethylamino)hydrazinyl]-N-[[(2,2-dimethylhydrazinyl)-ethylamino]methyl]methanamine (PubChem CID 146430861) has the molecular formula C8H25N7 and a molecular weight of 219.34 g/mol. Its IUPAC name is 1-[2-(dimethylamino)hydrazinyl]-N-[[(2,2-dimethylhydrazinyl)-ethylamino]methyl]methanamine.
| Compound Name | 1-[2-(dimethylamino)hydrazinyl]-N-[[(2,2-dimethylhydrazinyl)-ethylamino]methyl]methanamine |
|---|---|
| PubChem CID | 146430861 |
| Molecular Formula | C8H25N7 |
| Molecular Weight | 219.34 g/mol |
| Exact Mass | 219.22 |
| IUPAC Name | 1-[2-(dimethylamino)hydrazinyl]-N-[[(2,2-dimethylhydrazinyl)-ethylamino]methyl]methanamine |
| SMILES | CCN(CNCNNN(C)C)NN(C)C |
| InChI | InChI=1S/C8H25N7/c1-6-15(12-14(4)5)8-9-7-10-11-13(2)3/h9-12H,6-8H2,1-5H3 |
| InChIKey | LXLNWCMDQCNHMB-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.34 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|